C25H33N3O2 — CID 171556248
N-[5-[(1Z,3E,4Z)-2-[(Z)-1-cyanobut-1-enyl]-3-ethylidene-7-hydroxy-4-methyldeca-1,4-dienyl]-4-methyl-2-pyridinyl]formamide (PubChem CID 171556248) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[5-[(1Z,3E,4Z)-2-[(Z)-1-cyanobut-1-enyl]-3-ethylidene-7-hydroxy-4-methyldeca-1,4-dienyl]-4-methyl-2-pyridinyl]formamide.
| Compound Name | N-[5-[(1Z,3E,4Z)-2-[(Z)-1-cyanobut-1-enyl]-3-ethylidene-7-hydroxy-4-methyldeca-1,4-dienyl]-4-methyl-2-pyridinyl]formamide |
|---|---|
| PubChem CID | 171556248 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[5-[(1Z,3E,4Z)-2-[(Z)-1-cyanobut-1-enyl]-3-ethylidene-7-hydroxy-4-methyldeca-1,4-dienyl]-4-methyl-2-pyridinyl]formamide |
| SMILES | C/C=C(C(\C)=C/CC(O)CCC)/C(=C/c1cnc(NC=O)cc1C)C(/C#N)=C/CC |
| InChI | InChI=1S/C25H33N3O2/c1-6-9-20(15-26)24(14-21-16-27-25(28-17-29)13-19(21)5)23(8-3)18(4)11-12-22(30)10-7-2/h8-9,11,13-14,16-17,22,30H,6-7,10,12H2,1-5H3,(H,27,28,29)/b18-11-,20-9+,23-8+,24-14+ |
| InChIKey | KGVWECWDWBFBBM-ARIHQKHDSA-N |
| XLogP | 5.65 |
| TPSA | 86.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|