About 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane
3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane (PubChem CID 171556459) has the molecular formula C12H15BrN2O
and a molecular weight of 283.17 g/mol. Its IUPAC name is 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane.
Molecular Properties
| Compound Name | 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane |
| PubChem CID | 171556459 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane |
| SMILES | CC.Cc1cc2c(cn1)cc(Br)c(=O)n2C |
| InChI | InChI=1S/C10H9BrN2O.C2H6/c1-6-3-9-7(5-12-6)4-8(11)10(14)13(9)2;1-2/h3-5H,1-2H3;1-2H3 |
| InChIKey | BBJALIDTINASPV-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane?
The IUPAC name of 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane (CID 171556459) is 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane.
What is the SMILES notation for 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane?
The canonical SMILES for 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane is CC.Cc1cc2c(cn1)cc(Br)c(=O)n2C.
What is the InChIKey of 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane?
The InChIKey is BBJALIDTINASPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrN2O.C2H6/c1-6-3-9-7(5-12-6)4-8(11)10(14)13(9)2;1-2/h3-5H,1-2H3;1-2H3.
What are the key properties of 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane?
3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane has a molecular weight of 283.17 g/mol, XLogP of 3.03, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,7-dimethyl-1,6-naphthyridin-2-one;ethane is sourced from PubChem (CID 171556459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).