C16H21ClN2 — CID 17155648
1-phenyl-N-(pyridin-4-ylmethyl)butan-1-amine;hydrochloride (PubChem CID 17155648) has the molecular formula C16H21ClN2 and a molecular weight of 276.81 g/mol. Its IUPAC name is 1-phenyl-N-(pyridin-4-ylmethyl)butan-1-amine;hydrochloride.
| Compound Name | 1-phenyl-N-(pyridin-4-ylmethyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 17155648 |
| Molecular Formula | C16H21ClN2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 1-phenyl-N-(pyridin-4-ylmethyl)butan-1-amine;hydrochloride |
| SMILES | CCCC(NCc1ccncc1)c1ccccc1.Cl |
| InChI | InChI=1S/C16H20N2.ClH/c1-2-6-16(15-7-4-3-5-8-15)18-13-14-9-11-17-12-10-14;/h3-5,7-12,16,18H,2,6,13H2,1H3;1H |
| InChIKey | BDHWADAPQICWRE-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |