C22H24F3NO5 — CID 171556632
(1S,7R)-4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]tricyclo[5.2.1.02,6]dec-4-en-3-one (PubChem CID 171556632) has the molecular formula C22H24F3NO5 and a molecular weight of 439.43 g/mol. Its IUPAC name is (1S,7R)-4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]tricyclo[5.2.1.02,6]dec-4-en-3-one.
| Compound Name | (1S,7R)-4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]tricyclo[5.2.1.02,6]dec-4-en-3-one |
|---|---|
| PubChem CID | 171556632 |
| Molecular Formula | C22H24F3NO5 |
| Molecular Weight | 439.43 g/mol |
| Exact Mass | 439.16 |
| IUPAC Name | (1S,7R)-4-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]tricyclo[5.2.1.02,6]dec-4-en-3-one |
| SMILES | C[C@H]1O[C@H](C2=CC3C(C2=O)[C@H]2CC[C@@H]3C2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H24F3NO5/c1-9-17(27)19(29)21(31-15-4-2-3-14(26-15)22(23,24)25)20(30-9)13-8-12-10-5-6-11(7-10)16(12)18(13)28/h2-4,8-12,16-17,19-21,27,29H,5-7H2,1H3/t9-,10-,11+,12?,16?,17+,19+,20-,21-/m1/s1 |
| InChIKey | FUAWOMCGZSSFFS-KJHGKSTASA-N |
| XLogP | 2.53 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.43 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |