C24H37F3N4O4 — CID 171556642
tert-butyl 4-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl)piperidine-1-carboxylate;6-(trifluoromethyl)pyridin-2-amine (PubChem CID 171556642) has the molecular formula C24H37F3N4O4 and a molecular weight of 502.58 g/mol. Its IUPAC name is tert-butyl 4-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl)piperidine-1-carboxylate;6-(trifluoromethyl)pyridin-2-amine.
| Compound Name | tert-butyl 4-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl)piperidine-1-carboxylate;6-(trifluoromethyl)pyridin-2-amine |
|---|---|
| PubChem CID | 171556642 |
| Molecular Formula | C24H37F3N4O4 |
| Molecular Weight | 502.58 g/mol |
| Exact Mass | 502.28 |
| IUPAC Name | tert-butyl 4-(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyridin-5-yl)piperidine-1-carboxylate;6-(trifluoromethyl)pyridin-2-amine |
| SMILES | CC(C)(C)OC(=O)N1CCC(N2CCC3OC(C)(C)OC3C2)CC1.Nc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C18H32N2O4.C6H5F3N2/c1-17(2,3)24-16(21)19-9-6-13(7-10-19)20-11-8-14-15(12-20)23-18(4,5)22-14;7-6(8,9)4-2-1-3-5(10)11-4/h13-15H,6-12H2,1-5H3;1-3H,(H2,10,11) |
| InChIKey | HZYHAYXCVMBWTA-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.58 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |