About 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium
4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium (PubChem CID 171556695) has the molecular formula C10H13N2Y-
and a molecular weight of 250.13 g/mol. Its IUPAC name is 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium.
Molecular Properties
| Compound Name | 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium |
| PubChem CID | 171556695 |
| Molecular Formula | C10H13N2Y- |
| Molecular Weight | 250.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium |
| SMILES | C=Cc1cn[c-]nc1C=C.CC.[Y] |
| InChI | InChI=1S/C8H7N2.C2H6.Y/c1-3-7-5-9-6-10-8(7)4-2;1-2;/h3-5H,1-2H2;1-2H3;/q-1;; |
| InChIKey | COEBQUBSMMVTDL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.13 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium?
The IUPAC name of 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium (CID 171556695) is 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium.
What is the SMILES notation for 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium?
The canonical SMILES for 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium is C=Cc1cn[c-]nc1C=C.CC.[Y].
What is the InChIKey of 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium?
The InChIKey is COEBQUBSMMVTDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N2.C2H6.Y/c1-3-7-5-9-6-10-8(7)4-2;1-2;/h3-5H,1-2H2;1-2H3;/q-1;;.
What are the key properties of 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium?
4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium has a molecular weight of 250.13 g/mol, XLogP of 2.59, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-bis(ethenyl)-2H-pyrimidin-2-ide;ethane;yttrium is sourced from PubChem (CID 171556695), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).