C16H19F3N2O5 — CID 171556702
[(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methanol (PubChem CID 171556702) has the molecular formula C16H19F3N2O5 and a molecular weight of 376.33 g/mol. Its IUPAC name is [(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methanol.
| Compound Name | [(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methanol |
|---|---|
| PubChem CID | 171556702 |
| Molecular Formula | C16H19F3N2O5 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | [(1S,2R,6R,7R,8S)-4,4-dimethyl-7-[[6-(trifluoromethyl)-2-pyridinyl]amino]-3,5,9,11-tetraoxatricyclo[6.2.1.02,6]undecan-1-yl]methanol |
| SMILES | CC1(C)O[C@@H]2[C@@H](Nc3cccc(C(F)(F)F)n3)[C@H]3OC[C@](CO)(O3)[C@@H]2O1 |
| InChI | InChI=1S/C16H19F3N2O5/c1-14(2)24-11-10(13-23-7-15(6-22,26-13)12(11)25-14)21-9-5-3-4-8(20-9)16(17,18)19/h3-5,10-13,22H,6-7H2,1-2H3,(H,20,21)/t10-,11-,12-,13+,15+/m1/s1 |
| InChIKey | JXZOYQKGNRTPSG-NTASLKFISA-N |
| XLogP | 1.52 |
| TPSA | 82.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |