About 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine
1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171556704) has the molecular formula C17H21F3N4O2
and a molecular weight of 370.38 g/mol. Its IUPAC name is 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| PubChem CID | 171556704 |
| Molecular Formula | C17H21F3N4O2 |
| Molecular Weight | 370.38 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Nc1cncc(C(F)(F)F)n1.OC1CCN(Cc2ccccc2)CC1O |
| InChI | InChI=1S/C12H17NO2.C5H4F3N3/c14-11-6-7-13(9-12(11)15)8-10-4-2-1-3-5-10;6-5(7,8)3-1-10-2-4(9)11-3/h1-5,11-12,14-15H,6-9H2;1-2H,(H2,9,11) |
| InChIKey | BCCQKTAXLHEGAF-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The IUPAC name of 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (CID 171556704) is 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
What is the SMILES notation for 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The canonical SMILES for 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine is Nc1cncc(C(F)(F)F)n1.OC1CCN(Cc2ccccc2)CC1O.
What is the InChIKey of 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The InChIKey is BCCQKTAXLHEGAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO2.C5H4F3N3/c14-11-6-7-13(9-12(11)15)8-10-4-2-1-3-5-10;6-5(7,8)3-1-10-2-4(9)11-3/h1-5,11-12,14-15H,6-9H2;1-2H,(H2,9,11).
What are the key properties of 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine has a molecular weight of 370.38 g/mol, XLogP of 1.69, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylpiperidine-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine is sourced from PubChem (CID 171556704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).