C17H19F3N6O5 — CID 171556708
methyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate (PubChem CID 171556708) has the molecular formula C17H19F3N6O5 and a molecular weight of 444.37 g/mol. Its IUPAC name is methyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate.
| Compound Name | methyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 171556708 |
| Molecular Formula | C17H19F3N6O5 |
| Molecular Weight | 444.37 g/mol |
| Exact Mass | 444.14 |
| IUPAC Name | methyl 5-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]pyrazine-2-carboxylate |
| SMILES | COC(=O)c1cnc(NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)cn1 |
| InChI | InChI=1S/C17H19F3N6O5/c1-30-16(29)8-2-23-12(6-22-8)24-3-10-15(28)14(27)9(7-31-10)25-13-5-21-4-11(26-13)17(18,19)20/h2,4-6,9-10,14-15,27-28H,3,7H2,1H3,(H,23,24)(H,25,26)/t9-,10+,14+,15-/m0/s1 |
| InChIKey | PJMZUEDZHVTEEQ-RZCHIYRCSA-N |
| XLogP | 0.09 |
| TPSA | 151.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |