C18H21F3N2O5 — CID 171556723
[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl (2Z)-N-methylpenta-2,4-dienimidate (PubChem CID 171556723) has the molecular formula C18H21F3N2O5 and a molecular weight of 402.37 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl (2Z)-N-methylpenta-2,4-dienimidate.
| Compound Name | [(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl (2Z)-N-methylpenta-2,4-dienimidate |
|---|---|
| PubChem CID | 171556723 |
| Molecular Formula | C18H21F3N2O5 |
| Molecular Weight | 402.37 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl (2Z)-N-methylpenta-2,4-dienimidate |
| SMILES | C=C/C=C\C(=N/C)OC[C@H]1OC[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C18H21F3N2O5/c1-3-4-7-14(22-2)27-9-11-16(24)17(25)12(10-26-11)28-15-8-5-6-13(23-15)18(19,20)21/h3-8,11-12,16-17,24-25H,1,9-10H2,2H3/b7-4-,22-14+/t11-,12+,16+,17-/m1/s1 |
| InChIKey | GKEXJBMGTGOCRA-QCSXRFMSSA-N |
| XLogP | 1.76 |
| TPSA | 93.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.37 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|