C28H27F2NO6 — CID 171556779
(2R,3R,4S,5R)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3-hydroxy-2-[[4-[4-(1-hydroxyethenyl)phenyl]phenoxy]methyl]oxane-4-carbaldehyde (PubChem CID 171556779) has the molecular formula C28H27F2NO6 and a molecular weight of 511.52 g/mol. Its IUPAC name is (2R,3R,4S,5R)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3-hydroxy-2-[[4-[4-(1-hydroxyethenyl)phenyl]phenoxy]methyl]oxane-4-carbaldehyde.
| Compound Name | (2R,3R,4S,5R)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3-hydroxy-2-[[4-[4-(1-hydroxyethenyl)phenyl]phenoxy]methyl]oxane-4-carbaldehyde |
|---|---|
| PubChem CID | 171556779 |
| Molecular Formula | C28H27F2NO6 |
| Molecular Weight | 511.52 g/mol |
| Exact Mass | 511.18 |
| IUPAC Name | (2R,3R,4S,5R)-5-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3-hydroxy-2-[[4-[4-(1-hydroxyethenyl)phenyl]phenoxy]methyl]oxane-4-carbaldehyde |
| SMILES | C=C(O)c1ccc(-c2ccc(OC[C@H]3OC[C@H](Oc4cccc(C(C)(F)F)n4)[C@@H](C=O)[C@H]3O)cc2)cc1 |
| InChI | InChI=1S/C28H27F2NO6/c1-17(33)18-6-8-19(9-7-18)20-10-12-21(13-11-20)35-16-24-27(34)22(14-32)23(15-36-24)37-26-5-3-4-25(31-26)28(2,29)30/h3-14,22-24,27,33-34H,1,15-16H2,2H3/t22-,23+,24-,27-/m1/s1 |
| InChIKey | XNCYICTWDOHTKS-JPYYHWIRSA-N |
| XLogP | 4.79 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.52 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|