C17H18F3N3O4 — CID 171556833
(2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-phenyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556833) has the molecular formula C17H18F3N3O4 and a molecular weight of 385.34 g/mol. Its IUPAC name is (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-phenyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-phenyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556833 |
| Molecular Formula | C17H18F3N3O4 |
| Molecular Weight | 385.34 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | (2R,3R,4R,5R,6S)-2-(hydroxymethyl)-6-phenyl-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]oxane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](c2ccccc2)[C@H](Nc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C17H18F3N3O4/c18-17(19,20)11-6-7-21-16(22-11)23-12-14(26)13(25)10(8-24)27-15(12)9-4-2-1-3-5-9/h1-7,10,12-15,24-26H,8H2,(H,21,22,23)/t10-,12-,13+,14-,15+/m1/s1 |
| InChIKey | BZBCDUPNZXEAEH-LFHLZQBKSA-N |
| XLogP | 1.13 |
| TPSA | 107.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |