C17H21F3N6O3 — CID 171556842
(2R,3R,4R,5S)-2-[[[(1R)-1-pyrimidin-2-ylethyl]amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171556842) has the molecular formula C17H21F3N6O3 and a molecular weight of 414.39 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[[[(1R)-1-pyrimidin-2-ylethyl]amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[[[(1R)-1-pyrimidin-2-ylethyl]amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171556842 |
| Molecular Formula | C17H21F3N6O3 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2R,3R,4R,5S)-2-[[[(1R)-1-pyrimidin-2-ylethyl]amino]methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | C[C@@H](NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)c1ncccn1 |
| InChI | InChI=1S/C17H21F3N6O3/c1-9(16-22-3-2-4-23-16)24-5-11-15(28)14(27)10(8-29-11)25-13-7-21-6-12(26-13)17(18,19)20/h2-4,6-7,9-11,14-15,24,27-28H,5,8H2,1H3,(H,25,26)/t9-,10+,11-,14-,15+/m1/s1 |
| InChIKey | VOOINSLXEFEZCR-YHXLARSLSA-N |
| XLogP | 0.54 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |