About 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol
2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol (PubChem CID 171556854) has the molecular formula C14H21F3N2O3
and a molecular weight of 322.33 g/mol. Its IUPAC name is 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol.
Molecular Properties
| Compound Name | 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol |
| PubChem CID | 171556854 |
| Molecular Formula | C14H21F3N2O3 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol |
| SMILES | CC(C)C1OCCC(O)C1O.Cc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H16O3.C6H5F3N2/c1-5(2)8-7(10)6(9)3-4-11-8;1-4-10-3-2-5(11-4)6(7,8)9/h5-10H,3-4H2,1-2H3;2-3H,1H3 |
| InChIKey | RKVACGPPUXSKEA-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol?
The IUPAC name of 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol (CID 171556854) is 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol.
What is the SMILES notation for 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol?
The canonical SMILES for 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol is CC(C)C1OCCC(O)C1O.Cc1nccc(C(F)(F)F)n1.
What is the InChIKey of 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol?
The InChIKey is RKVACGPPUXSKEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O3.C6H5F3N2/c1-5(2)8-7(10)6(9)3-4-11-8;1-4-10-3-2-5(11-4)6(7,8)9/h5-10H,3-4H2,1-2H3;2-3H,1H3.
What are the key properties of 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol?
2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol has a molecular weight of 322.33 g/mol, XLogP of 1.96, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(trifluoromethyl)pyrimidine;2-propan-2-yloxane-3,4-diol is sourced from PubChem (CID 171556854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).