C11H12F3LiNO3- — CID 171556931
lithium (2S,3S,4S)-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]pentane-2,3-diol (PubChem CID 171556931) has the molecular formula C11H12F3LiNO3- and a molecular weight of 270.16 g/mol. Its IUPAC name is lithium (2S,3S,4S)-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]pentane-2,3-diol.
| Compound Name | lithium (2S,3S,4S)-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]pentane-2,3-diol |
|---|---|
| PubChem CID | 171556931 |
| Molecular Formula | C11H12F3LiNO3- |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | lithium (2S,3S,4S)-4-[[6-(trifluoromethyl)-2-pyridinyl]oxy]pentane-2,3-diol |
| SMILES | [CH2-][C@H](O)[C@H](O)[C@H]([CH2-])Oc1cccc(C(F)(F)F)n1.[Li+] |
| InChI | InChI=1S/C11H12F3NO3.Li/c1-6(16)10(17)7(2)18-9-5-3-4-8(15-9)11(12,13)14;/h3-7,10,16-17H,1-2H2;/q-2;+1/t6-,7-,10-;/m0./s1 |
| InChIKey | ACLAGCPEAJCNIP-SXEDSFTMSA-N |
| XLogP | -1.76 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|