C14H18F3N3O3S — CID 171556967
N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171556967) has the molecular formula C14H18F3N3O3S and a molecular weight of 365.38 g/mol. Its IUPAC name is N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 171556967 |
| Molecular Formula | C14H18F3N3O3S |
| Molecular Weight | 365.38 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | N-[(3aS,6R,7R,7aR)-2,2-dimethyl-6-methylsulfanyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CS[C@H]1OC[C@@H]2OC(C)(C)O[C@@H]2[C@H]1Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H18F3N3O3S/c1-13(2)22-7-6-21-11(24-3)9(10(7)23-13)20-12-18-5-4-8(19-12)14(15,16)17/h4-5,7,9-11H,6H2,1-3H3,(H,18,19,20)/t7-,9+,10-,11+/m0/s1 |
| InChIKey | CNMIGXYCERDYPL-CDEVMZEPSA-N |
| XLogP | 2.52 |
| TPSA | 65.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |