About 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine
2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171556986) has the molecular formula C14H18F3N3O5
and a molecular weight of 365.31 g/mol. Its IUPAC name is 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 171556986 |
| Molecular Formula | C14H18F3N3O5 |
| Molecular Weight | 365.31 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | C#CCOc1cc(C(F)(F)F)nc(N)n1.OCC1OCCC(O)C1O |
| InChI | InChI=1S/C8H6F3N3O.C6H12O4/c1-2-3-15-6-4-5(8(9,10)11)13-7(12)14-6;7-3-5-6(9)4(8)1-2-10-5/h1,4H,3H2,(H2,12,13,14);4-9H,1-3H2 |
| InChIKey | SWWGMNWRUXLAOG-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 130.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.31 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine (CID 171556986) is 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine is C#CCOc1cc(C(F)(F)F)nc(N)n1.OCC1OCCC(O)C1O.
What is the InChIKey of 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is SWWGMNWRUXLAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6F3N3O.C6H12O4/c1-2-3-15-6-4-5(8(9,10)11)13-7(12)14-6;7-3-5-6(9)4(8)1-2-10-5/h1,4H,3H2,(H2,12,13,14);4-9H,1-3H2.
What are the key properties of 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine?
2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 365.31 g/mol, XLogP of -0.42, 3 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(hydroxymethyl)oxane-3,4-diol;4-prop-2-ynoxy-6-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 171556986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).