C15H20F3NO5 — CID 171557020
(2R,3R,4S,5R,6R)-6-(3-hydroxypropyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557020) has the molecular formula C15H20F3NO5 and a molecular weight of 351.32 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(3-hydroxypropyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(3-hydroxypropyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557020 |
| Molecular Formula | C15H20F3NO5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(3-hydroxypropyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](CCCO)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H20F3NO5/c1-8-12(21)13(22)14(9(23-8)4-3-7-20)24-11-6-2-5-10(19-11)15(16,17)18/h2,5-6,8-9,12-14,20-22H,3-4,7H2,1H3/t8-,9-,12+,13+,14+/m1/s1 |
| InChIKey | XHSBQAVKUZTPPW-IZPVPAKOSA-N |
| XLogP | 1.13 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |