C10H12F3N3O2S — CID 171557046
(3R,4R,5R)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]thiane-3,4-diol (PubChem CID 171557046) has the molecular formula C10H12F3N3O2S and a molecular weight of 295.29 g/mol. Its IUPAC name is (3R,4R,5R)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]thiane-3,4-diol.
| Compound Name | (3R,4R,5R)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]thiane-3,4-diol |
|---|---|
| PubChem CID | 171557046 |
| Molecular Formula | C10H12F3N3O2S |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | (3R,4R,5R)-5-[[4-(trifluoromethyl)pyrimidin-2-yl]amino]thiane-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2nccc(C(F)(F)F)n2)CSC[C@@H]1O |
| InChI | InChI=1S/C10H12F3N3O2S/c11-10(12,13)7-1-2-14-9(16-7)15-5-3-19-4-6(17)8(5)18/h1-2,5-6,8,17-18H,3-4H2,(H,14,15,16)/t5-,6-,8+/m0/s1 |
| InChIKey | XIEAZGLBABEPEP-VMHSAVOQSA-N |
| XLogP | 0.74 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |