C19H19F3N6O4 — CID 171557062
N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide (PubChem CID 171557062) has the molecular formula C19H19F3N6O4 and a molecular weight of 452.39 g/mol. Its IUPAC name is N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide.
| Compound Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide |
|---|---|
| PubChem CID | 171557062 |
| Molecular Formula | C19H19F3N6O4 |
| Molecular Weight | 452.39 g/mol |
| Exact Mass | 452.14 |
| IUPAC Name | N-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methyl]-1H-benzimidazole-2-carboxamide |
| SMILES | O=C(NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C19H19F3N6O4/c20-19(21,22)13-6-23-7-14(28-13)25-11-8-32-12(16(30)15(11)29)5-24-18(31)17-26-9-3-1-2-4-10(9)27-17/h1-4,6-7,11-12,15-16,29-30H,5,8H2,(H,24,31)(H,25,28)(H,26,27)/t11-,12+,15+,16-/m0/s1 |
| InChIKey | CNFBSNZKSLLEOF-OJDYBEQGSA-N |
| XLogP | 0.70 |
| TPSA | 145.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |