C27H33F3N4O8 — CID 171557068
benzyl 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetate (PubChem CID 171557068) has the molecular formula C27H33F3N4O8 and a molecular weight of 598.58 g/mol. Its IUPAC name is benzyl 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetate.
| Compound Name | benzyl 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171557068 |
| Molecular Formula | C27H33F3N4O8 |
| Molecular Weight | 598.58 g/mol |
| Exact Mass | 598.23 |
| IUPAC Name | benzyl 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1ccnc(C(F)(F)F)n1)CO[C@@H]2CNC(=O)COCCOCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H33F3N4O8/c1-26(2)41-23-18(33-20-8-9-31-25(34-20)27(28,29)30)14-39-19(24(23)42-26)12-32-21(35)15-37-10-11-38-16-22(36)40-13-17-6-4-3-5-7-17/h3-9,18-19,23-24H,10-16H2,1-2H3,(H,32,35)(H,31,33,34)/t18-,19+,23+,24-/m0/s1 |
| InChIKey | HRHMBOYACKKUED-LUZMIZLMSA-N |
| XLogP | 2.09 |
| TPSA | 139.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.58 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|