C18H27F3N4O5 — CID 171557101
N-[(3aR,4R,7S,7aR)-4-[2-(2-aminoethoxy)ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557101) has the molecular formula C18H27F3N4O5 and a molecular weight of 436.43 g/mol. Its IUPAC name is N-[(3aR,4R,7S,7aR)-4-[2-(2-aminoethoxy)ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(3aR,4R,7S,7aR)-4-[2-(2-aminoethoxy)ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557101 |
| Molecular Formula | C18H27F3N4O5 |
| Molecular Weight | 436.43 g/mol |
| Exact Mass | 436.19 |
| IUPAC Name | N-[(3aR,4R,7S,7aR)-4-[2-(2-aminoethoxy)ethoxymethyl]-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1cncc(C(F)(F)F)n1)CO[C@@H]2COCCOCCN |
| InChI | InChI=1S/C18H27F3N4O5/c1-17(2)29-15-11(24-14-8-23-7-13(25-14)18(19,20)21)9-28-12(16(15)30-17)10-27-6-5-26-4-3-22/h7-8,11-12,15-16H,3-6,9-10,22H2,1-2H3,(H,24,25)/t11-,12+,15+,16-/m0/s1 |
| InChIKey | SPUURQWDQXTYBH-OJDYBEQGSA-N |
| XLogP | 1.19 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.43 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|