C12H14F6N4O2 — CID 171557102
(3S,4R,5S)-1-(2,2,2-trifluoroethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol (PubChem CID 171557102) has the molecular formula C12H14F6N4O2 and a molecular weight of 360.26 g/mol. Its IUPAC name is (3S,4R,5S)-1-(2,2,2-trifluoroethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol.
| Compound Name | (3S,4R,5S)-1-(2,2,2-trifluoroethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol |
|---|---|
| PubChem CID | 171557102 |
| Molecular Formula | C12H14F6N4O2 |
| Molecular Weight | 360.26 g/mol |
| Exact Mass | 360.10 |
| IUPAC Name | (3S,4R,5S)-1-(2,2,2-trifluoroethyl)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cncc(C(F)(F)F)n2)CN(CC(F)(F)F)C[C@@H]1O |
| InChI | InChI=1S/C12H14F6N4O2/c13-11(14,15)5-22-3-6(10(24)7(23)4-22)20-9-2-19-1-8(21-9)12(16,17)18/h1-2,6-7,10,23-24H,3-5H2,(H,20,21)/t6-,7-,10+/m0/s1 |
| InChIKey | YIJLSEZCPPBGSM-MHYGZLNHSA-N |
| XLogP | 0.88 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.26 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |