C21H32F3N3O9 — CID 171557108
tert-butyl 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate (PubChem CID 171557108) has the molecular formula C21H32F3N3O9 and a molecular weight of 527.49 g/mol. Its IUPAC name is tert-butyl 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate.
| Compound Name | tert-butyl 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 171557108 |
| Molecular Formula | C21H32F3N3O9 |
| Molecular Weight | 527.49 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | tert-butyl 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetate |
| SMILES | CC(C)(C)OC(=O)COCCOCCOc1cc(C(F)(F)F)nc(N[C@H]2CO[C@H](CO)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C21H32F3N3O9/c1-20(2,3)36-16(29)11-33-5-4-32-6-7-34-15-8-14(21(22,23)24)26-19(27-15)25-12-10-35-13(9-28)18(31)17(12)30/h8,12-13,17-18,28,30-31H,4-7,9-11H2,1-3H3,(H,25,26,27)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | YEPKLMBLNNXDME-DECQCQTCSA-N |
| XLogP | 0.14 |
| TPSA | 161.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.49 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|