C16H18F3NO6 — CID 171557131
methyl (E)-3-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]prop-2-enoate (PubChem CID 171557131) has the molecular formula C16H18F3NO6 and a molecular weight of 377.32 g/mol. Its IUPAC name is methyl (E)-3-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 171557131 |
| Molecular Formula | C16H18F3NO6 |
| Molecular Weight | 377.32 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | methyl (E)-3-[(2R,3R,4S,5R,6R)-4,5-dihydroxy-6-methyl-3-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/[C@H]1O[C@H](C)[C@H](O)[C@H](O)[C@H]1Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C16H18F3NO6/c1-8-13(22)14(23)15(9(25-8)6-7-12(21)24-2)26-11-5-3-4-10(20-11)16(17,18)19/h3-9,13-15,22-23H,1-2H3/b7-6+/t8-,9-,13+,14+,15+/m1/s1 |
| InChIKey | GJHIRSVCKYXSNE-RKFXGXHUSA-N |
| XLogP | 1.09 |
| TPSA | 98.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|