C19H28F3N5O6 — CID 171557140
methyl 6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoylamino]hexanoate (PubChem CID 171557140) has the molecular formula C19H28F3N5O6 and a molecular weight of 479.46 g/mol. Its IUPAC name is methyl 6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoylamino]hexanoate.
| Compound Name | methyl 6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoylamino]hexanoate |
|---|---|
| PubChem CID | 171557140 |
| Molecular Formula | C19H28F3N5O6 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.20 |
| IUPAC Name | methyl 6-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H28F3N5O6/c1-32-15(28)5-3-2-4-6-24-18(31)25-7-12-17(30)16(29)11(10-33-12)26-14-9-23-8-13(27-14)19(20,21)22/h8-9,11-12,16-17,29-30H,2-7,10H2,1H3,(H,26,27)(H2,24,25,31)/t11-,12+,16+,17-/m0/s1 |
| InChIKey | DQXQYGUKBQOOOJ-SONRMIBWSA-N |
| XLogP | 0.43 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|