C10H13F3N4O2 — CID 171557158
(3S,4R,5S)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol (PubChem CID 171557158) has the molecular formula C10H13F3N4O2 and a molecular weight of 278.23 g/mol. Its IUPAC name is (3S,4R,5S)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol.
| Compound Name | (3S,4R,5S)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol |
|---|---|
| PubChem CID | 171557158 |
| Molecular Formula | C10H13F3N4O2 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 278.10 |
| IUPAC Name | (3S,4R,5S)-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]piperidine-3,4-diol |
| SMILES | O[C@@H]1[C@@H](Nc2cncc(C(F)(F)F)n2)CNC[C@@H]1O |
| InChI | InChI=1S/C10H13F3N4O2/c11-10(12,13)7-3-15-4-8(17-7)16-5-1-14-2-6(18)9(5)19/h3-6,9,14,18-19H,1-2H2,(H,16,17)/t5-,6-,9+/m0/s1 |
| InChIKey | VFQUSKFKMFTXJD-ATVXKPNKSA-N |
| XLogP | -0.40 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |