C24H34F3N3O6 — CID 171557186
tert-butyl 2-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate (PubChem CID 171557186) has the molecular formula C24H34F3N3O6 and a molecular weight of 517.55 g/mol. Its IUPAC name is tert-butyl 2-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate.
| Compound Name | tert-butyl 2-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
|---|---|
| PubChem CID | 171557186 |
| Molecular Formula | C24H34F3N3O6 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | tert-butyl 2-[[(2R,3R,4S,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxan-2-yl]methyl]-2,7-diazaspiro[3.5]nonane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(C[C@H]1OC[C@H](Oc3cccc(C(F)(F)F)n3)[C@@H](O)[C@H]1O)C2 |
| InChI | InChI=1S/C24H34F3N3O6/c1-22(2,3)36-21(33)30-9-7-23(8-10-30)13-29(14-23)11-15-19(31)20(32)16(12-34-15)35-18-6-4-5-17(28-18)24(25,26)27/h4-6,15-16,19-20,31-32H,7-14H2,1-3H3/t15-,16+,19+,20-/m1/s1 |
| InChIKey | CDEGASBEFBEGPE-GIYDNNGJSA-N |
| XLogP | 2.30 |
| TPSA | 104.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |