C12H15F3N2O5 — CID 171557206
(2R,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]oxyoxane-3,4-diol (PubChem CID 171557206) has the molecular formula C12H15F3N2O5 and a molecular weight of 324.26 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]oxyoxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]oxyoxane-3,4-diol |
|---|---|
| PubChem CID | 171557206 |
| Molecular Formula | C12H15F3N2O5 |
| Molecular Weight | 324.26 g/mol |
| Exact Mass | 324.09 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(hydroxymethyl)-2-methyl-5-[4-(trifluoromethyl)pyrimidin-2-yl]oxyoxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](CO)[C@H](Oc2nccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C12H15F3N2O5/c1-5-8(19)9(20)10(6(4-18)21-5)22-11-16-3-2-7(17-11)12(13,14)15/h2-3,5-6,8-10,18-20H,4H2,1H3/t5-,6-,8+,9+,10+/m1/s1 |
| InChIKey | FKSYDIUKEIGEAJ-IWSQBXEPSA-N |
| XLogP | -0.26 |
| TPSA | 104.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.26 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |