About 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine
3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine (PubChem CID 171557271) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine |
| PubChem CID | 171557271 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine |
| SMILES | CN1CCN(CC2C=NC=CCC2)CC1 |
| InChI | InChI=1S/C12H21N3/c1-14-6-8-15(9-7-14)11-12-4-2-3-5-13-10-12/h3,5,10,12H,2,4,6-9,11H2,1H3 |
| InChIKey | MUAVFXWLVMPKIK-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine?
The IUPAC name of 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine (CID 171557271) is 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine.
What is the SMILES notation for 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine?
The canonical SMILES for 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine is CN1CCN(CC2C=NC=CCC2)CC1.
What is the InChIKey of 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine?
The InChIKey is MUAVFXWLVMPKIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-14-6-8-15(9-7-14)11-12-4-2-3-5-13-10-12/h3,5,10,12H,2,4,6-9,11H2,1H3.
What are the key properties of 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine?
3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine has a molecular weight of 207.32 g/mol, XLogP of 1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-methylpiperazin-1-yl)methyl]-4,5-dihydro-3H-azepine is sourced from PubChem (CID 171557271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).