About 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine
1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine (PubChem CID 171557340) has the molecular formula C12H23N3O2
and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine.
Molecular Properties
| Compound Name | 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine |
| PubChem CID | 171557340 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine |
| SMILES | CC(C)N1CCC(O)C(O)C1.Nc1cc[nH]c1 |
| InChI | InChI=1S/C8H17NO2.C4H6N2/c1-6(2)9-4-3-7(10)8(11)5-9;5-4-1-2-6-3-4/h6-8,10-11H,3-5H2,1-2H3;1-3,6H,5H2 |
| InChIKey | UGZNYZVVNQHLKB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine?
The IUPAC name of 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine (CID 171557340) is 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine.
What is the SMILES notation for 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine?
The canonical SMILES for 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine is CC(C)N1CCC(O)C(O)C1.Nc1cc[nH]c1.
What is the InChIKey of 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine?
The InChIKey is UGZNYZVVNQHLKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C4H6N2/c1-6(2)9-4-3-7(10)8(11)5-9;5-4-1-2-6-3-4/h6-8,10-11H,3-5H2,1-2H3;1-3,6H,5H2.
What are the key properties of 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine?
1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine has a molecular weight of 241.33 g/mol, XLogP of 0.42, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine is sourced from PubChem (CID 171557340), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).