C12H23N3O2 — CID 171557340
1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine (PubChem CID 171557340) has the molecular formula C12H23N3O2 and a molecular weight of 241.33 g/mol. Its IUPAC name is 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine.
| Compound Name | 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine |
|---|---|
| PubChem CID | 171557340 |
| Molecular Formula | C12H23N3O2 |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.18 |
| IUPAC Name | 1-propan-2-ylpiperidine-3,4-diol;1H-pyrrol-3-amine |
| SMILES | CC(C)N1CCC(O)C(O)C1.Nc1cc[nH]c1 |
| InChI | InChI=1S/C8H17NO2.C4H6N2/c1-6(2)9-4-3-7(10)8(11)5-9;5-4-1-2-6-3-4/h6-8,10-11H,3-5H2,1-2H3;1-3,6H,5H2 |
| InChIKey | UGZNYZVVNQHLKB-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |