C15H16F3N3O4 — CID 171557361
(2R,3R,4S,5R,6R)-2-methyl-6-(1H-pyrazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557361) has the molecular formula C15H16F3N3O4 and a molecular weight of 359.30 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-methyl-6-(1H-pyrazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-2-methyl-6-(1H-pyrazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557361 |
| Molecular Formula | C15H16F3N3O4 |
| Molecular Weight | 359.30 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-methyl-6-(1H-pyrazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](c2ccn[nH]2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C15H16F3N3O4/c1-7-11(22)12(23)14(13(24-7)8-5-6-19-21-8)25-10-4-2-3-9(20-10)15(16,17)18/h2-7,11-14,22-23H,1H3,(H,19,21)/t7-,11+,12+,13-,14-/m1/s1 |
| InChIKey | YJVNLXNHKHYFOJ-CKXAMLNGSA-N |
| XLogP | 1.45 |
| TPSA | 100.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.30 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |