About 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite
1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite (PubChem CID 171557425) has the molecular formula C13H19F4N3O3
and a molecular weight of 341.31 g/mol. Its IUPAC name is 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite.
Molecular Properties
| Compound Name | 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite |
| PubChem CID | 171557425 |
| Molecular Formula | C13H19F4N3O3 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite |
| SMILES | CC(C)N1CCC(O)C(O)C1.FOc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H17NO2.C5H2F4N2O/c1-6(2)9-4-3-7(10)8(11)5-9;6-5(7,8)3-1-10-2-4(11-3)12-9/h6-8,10-11H,3-5H2,1-2H3;1-2H |
| InChIKey | XNZMFZKAVJQWIK-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite?
The IUPAC name of 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite (CID 171557425) is 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite.
What is the SMILES notation for 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite?
The canonical SMILES for 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite is CC(C)N1CCC(O)C(O)C1.FOc1cncc(C(F)(F)F)n1.
What is the InChIKey of 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite?
The InChIKey is XNZMFZKAVJQWIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO2.C5H2F4N2O/c1-6(2)9-4-3-7(10)8(11)5-9;6-5(7,8)3-1-10-2-4(11-3)12-9/h6-8,10-11H,3-5H2,1-2H3;1-2H.
What are the key properties of 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite?
1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite has a molecular weight of 341.31 g/mol, XLogP of 1.58, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-propan-2-ylpiperidine-3,4-diol;[6-(trifluoromethyl)pyrazin-2-yl] hypofluorite is sourced from PubChem (CID 171557425), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).