C19H25F3N6O5 — CID 171557429
(2R,3R,4R,5S)-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171557429) has the molecular formula C19H25F3N6O5 and a molecular weight of 474.44 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557429 |
| Molecular Formula | C19H25F3N6O5 |
| Molecular Weight | 474.44 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | (2R,3R,4R,5S)-2-[2-[2-(pyrazin-2-ylamino)ethoxy]ethoxymethyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CO[C@@H]1COCCOCCNc1cnccn1 |
| InChI | InChI=1S/C19H25F3N6O5/c20-19(21,22)14-7-24-9-16(28-14)27-12-10-33-13(18(30)17(12)29)11-32-6-5-31-4-3-26-15-8-23-1-2-25-15/h1-2,7-9,12-13,17-18,29-30H,3-6,10-11H2,(H,25,26)(H,27,28)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | PYMPBDSNOUPUGI-DECQCQTCSA-N |
| XLogP | 0.33 |
| TPSA | 143.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.44 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|