C18H28F3N5O6 — CID 171557491
6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoic acid;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557491) has the molecular formula C18H28F3N5O6 and a molecular weight of 467.45 g/mol. Its IUPAC name is 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoic acid;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoic acid;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557491 |
| Molecular Formula | C18H28F3N5O6 |
| Molecular Weight | 467.45 g/mol |
| Exact Mass | 467.20 |
| IUPAC Name | 6-[(3,4-dihydroxyoxan-2-yl)methylcarbamoylamino]hexanoic acid;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Nc1cncc(C(F)(F)F)n1.O=C(O)CCCCCNC(=O)NCC1OCCC(O)C1O |
| InChI | InChI=1S/C13H24N2O6.C5H4F3N3/c16-9-5-7-21-10(12(9)19)8-15-13(20)14-6-3-1-2-4-11(17)18;6-5(7,8)3-1-10-2-4(9)11-3/h9-10,12,16,19H,1-8H2,(H,17,18)(H2,14,15,20);1-2H,(H2,9,11) |
| InChIKey | AAQBLXMJLIICFM-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 179.92 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.45 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|