C22H26F3N3O4 — CID 171557517
(2R,3R,4S,5R,6S)-2-methyl-6-(4-piperazin-1-ylphenyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557517) has the molecular formula C22H26F3N3O4 and a molecular weight of 453.46 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-methyl-6-(4-piperazin-1-ylphenyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-methyl-6-(4-piperazin-1-ylphenyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557517 |
| Molecular Formula | C22H26F3N3O4 |
| Molecular Weight | 453.46 g/mol |
| Exact Mass | 453.19 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-methyl-6-(4-piperazin-1-ylphenyl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@@H](c2ccc(N3CCNCC3)cc2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C22H26F3N3O4/c1-13-18(29)19(30)21(32-17-4-2-3-16(27-17)22(23,24)25)20(31-13)14-5-7-15(8-6-14)28-11-9-26-10-12-28/h2-8,13,18-21,26,29-30H,9-12H2,1H3/t13-,18+,19+,20+,21-/m1/s1 |
| InChIKey | NGQRXKMVLLPPBR-GFMAEHNQSA-N |
| XLogP | 2.14 |
| TPSA | 87.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.46 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|