C21H19F3N2O5 — CID 171557524
(2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2-oxazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557524) has the molecular formula C21H19F3N2O5 and a molecular weight of 436.39 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2-oxazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2-oxazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557524 |
| Molecular Formula | C21H19F3N2O5 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-methyl-6-(3-phenyl-1,2-oxazol-5-yl)-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C[C@H]1O[C@H](c2cc(-c3ccccc3)no2)[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C21H19F3N2O5/c1-11-17(27)18(28)20(30-16-9-5-8-15(25-16)21(22,23)24)19(29-11)14-10-13(26-31-14)12-6-3-2-4-7-12/h2-11,17-20,27-28H,1H3/t11-,17+,18+,19-,20-/m1/s1 |
| InChIKey | IZINVZHSGWJIHX-YDMVOOKBSA-N |
| XLogP | 3.38 |
| TPSA | 97.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |