C18H21F3N2O7 — CID 171557538
[(3R,4R,5S)-3,4-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]oxan-2-yl]methyl acetate (PubChem CID 171557538) has the molecular formula C18H21F3N2O7 and a molecular weight of 434.37 g/mol. Its IUPAC name is [(3R,4R,5S)-3,4-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]oxan-2-yl]methyl acetate.
| Compound Name | [(3R,4R,5S)-3,4-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 171557538 |
| Molecular Formula | C18H21F3N2O7 |
| Molecular Weight | 434.37 g/mol |
| Exact Mass | 434.13 |
| IUPAC Name | [(3R,4R,5S)-3,4-diacetyloxy-5-[[4-(trifluoromethyl)pyrimidin-2-yl]methyl]oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OCC1OC[C@H](Cc2nccc(C(F)(F)F)n2)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H21F3N2O7/c1-9(24)27-8-13-17(30-11(3)26)16(29-10(2)25)12(7-28-13)6-15-22-5-4-14(23-15)18(19,20)21/h4-5,12-13,16-17H,6-8H2,1-3H3/t12-,13?,16+,17-/m0/s1 |
| InChIKey | GCCXGMPLWAVSKE-ZKOLMKBRSA-N |
| XLogP | 1.48 |
| TPSA | 113.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|