C19H25F3N4O6 — CID 171557591
4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid (PubChem CID 171557591) has the molecular formula C19H25F3N4O6 and a molecular weight of 462.43 g/mol. Its IUPAC name is 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 171557591 |
| Molecular Formula | C19H25F3N4O6 |
| Molecular Weight | 462.43 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 4-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylcarbamoyl]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(C(=O)NC[C@H]2OC[C@H](Nc3cncc(C(F)(F)F)n3)[C@@H](O)[C@H]2O)CC1 |
| InChI | InChI=1S/C19H25F3N4O6/c20-19(21,22)13-6-23-7-14(26-13)25-11-8-32-12(16(28)15(11)27)5-24-17(29)9-1-3-10(4-2-9)18(30)31/h6-7,9-12,15-16,27-28H,1-5,8H2,(H,24,29)(H,25,26)(H,30,31)/t9?,10?,11-,12+,15+,16-/m0/s1 |
| InChIKey | OEWCCJHXGHHQAT-UFZXHTCVSA-N |
| XLogP | 0.40 |
| TPSA | 153.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.43 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |