About 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine
6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 171557608) has the molecular formula C11H17F3N4O4
and a molecular weight of 326.28 g/mol. Its IUPAC name is 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine.
Molecular Properties
| Compound Name | 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine |
| PubChem CID | 171557608 |
| Molecular Formula | C11H17F3N4O4 |
| Molecular Weight | 326.28 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | NC1CC(O)C(O)C(CO)O1.Nc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C6H13NO4.C5H4F3N3/c7-5-1-3(9)6(10)4(2-8)11-5;6-5(7,8)3-1-2-10-4(9)11-3/h3-6,8-10H,1-2,7H2;1-2H,(H2,9,10,11) |
| InChIKey | GPNOJALZUZWZQC-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 147.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.28 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine?
The IUPAC name of 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine (CID 171557608) is 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine.
What is the SMILES notation for 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine?
The canonical SMILES for 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine is NC1CC(O)C(O)C(CO)O1.Nc1nccc(C(F)(F)F)n1.
What is the InChIKey of 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine?
The InChIKey is GPNOJALZUZWZQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4.C5H4F3N3/c7-5-1-3(9)6(10)4(2-8)11-5;6-5(7,8)3-1-2-10-4(9)11-3/h3-6,8-10H,1-2,7H2;1-2H,(H2,9,10,11).
What are the key properties of 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine?
6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine has a molecular weight of 326.28 g/mol, XLogP of -1.15, 1 rotatable bonds, 5 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2-(hydroxymethyl)oxane-3,4-diol;4-(trifluoromethyl)pyrimidin-2-amine is sourced from PubChem (CID 171557608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).