C14H16F3N7O3 — CID 171557609
(2R,3R,4R,5S)-2-[(1,3,5-triazin-2-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol (PubChem CID 171557609) has the molecular formula C14H16F3N7O3 and a molecular weight of 387.32 g/mol. Its IUPAC name is (2R,3R,4R,5S)-2-[(1,3,5-triazin-2-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol.
| Compound Name | (2R,3R,4R,5S)-2-[(1,3,5-triazin-2-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557609 |
| Molecular Formula | C14H16F3N7O3 |
| Molecular Weight | 387.32 g/mol |
| Exact Mass | 387.13 |
| IUPAC Name | (2R,3R,4R,5S)-2-[(1,3,5-triazin-2-ylamino)methyl]-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxane-3,4-diol |
| SMILES | O[C@@H]1[C@H](O)[C@@H](Nc2cncc(C(F)(F)F)n2)CO[C@@H]1CNc1ncncn1 |
| InChI | InChI=1S/C14H16F3N7O3/c15-14(16,17)9-2-18-3-10(24-9)23-7-4-27-8(12(26)11(7)25)1-20-13-21-5-19-6-22-13/h2-3,5-8,11-12,25-26H,1,4H2,(H,23,24)(H,19,20,21,22)/t7-,8+,11+,12-/m0/s1 |
| InChIKey | OLEKMDMZPCBUAW-MDSNHJATSA-N |
| XLogP | -0.31 |
| TPSA | 138.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.32 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |