About ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite
ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite (PubChem CID 171557611) has the molecular formula C14H22F4N2O3S
and a molecular weight of 374.40 g/mol. Its IUPAC name is ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite.
Molecular Properties
| Compound Name | ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite |
| PubChem CID | 171557611 |
| Molecular Formula | C14H22F4N2O3S |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite |
| SMILES | CC.CCC1CC(O)C(O)CO1.FSc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H14O3.C5H2F4N2S.C2H6/c1-2-5-3-6(8)7(9)4-10-5;6-5(7,8)3-1-2-10-4(11-3)12-9;1-2/h5-9H,2-4H2,1H3;1-2H;1-2H3 |
| InChIKey | KCMUALJAEDDFOE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite?
The IUPAC name of ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite (CID 171557611) is ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite.
What is the SMILES notation for ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite?
The canonical SMILES for ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite is CC.CCC1CC(O)C(O)CO1.FSc1nccc(C(F)(F)F)n1.
What is the InChIKey of ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite?
The InChIKey is KCMUALJAEDDFOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O3.C5H2F4N2S.C2H6/c1-2-5-3-6(8)7(9)4-10-5;6-5(7,8)3-1-2-10-4(11-3)12-9;1-2/h5-9H,2-4H2,1H3;1-2H;1-2H3.
What are the key properties of ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite?
ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite has a molecular weight of 374.40 g/mol, XLogP of 3.41, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-ethyloxane-3,4-diol;[4-(trifluoromethyl)pyrimidin-2-yl] thiohypofluorite is sourced from PubChem (CID 171557611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).