C13H12F3NO4 — CID 171557619
(2R,3R,4S,5S)-2-ethynyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557619) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is (2R,3R,4S,5S)-2-ethynyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5S)-2-ethynyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557619 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2R,3R,4S,5S)-2-ethynyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | C#C[C@H]1OC[C@H](Oc2cccc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H12F3NO4/c1-2-7-11(18)12(19)8(6-20-7)21-10-5-3-4-9(17-10)13(14,15)16/h1,3-5,7-8,11-12,18-19H,6H2/t7-,8+,11+,12-/m1/s1 |
| InChIKey | ADIIEEAXJYICEV-UFGYURQFSA-N |
| XLogP | 0.60 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|