C14H18F3NO5 — CID 171557659
(2R,3R,4S,5R,6R)-6-(1-hydroxyethyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol (PubChem CID 171557659) has the molecular formula C14H18F3NO5 and a molecular weight of 337.29 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-6-(1-hydroxyethyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol.
| Compound Name | (2R,3R,4S,5R,6R)-6-(1-hydroxyethyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
|---|---|
| PubChem CID | 171557659 |
| Molecular Formula | C14H18F3NO5 |
| Molecular Weight | 337.29 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-6-(1-hydroxyethyl)-2-methyl-5-[[6-(trifluoromethyl)-2-pyridinyl]oxy]oxane-3,4-diol |
| SMILES | CC(O)[C@H]1O[C@H](C)[C@H](O)[C@H](O)[C@H]1Oc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H18F3NO5/c1-6(19)12-13(11(21)10(20)7(2)22-12)23-9-5-3-4-8(18-9)14(15,16)17/h3-7,10-13,19-21H,1-2H3/t6?,7-,10+,11+,12-,13-/m1/s1 |
| InChIKey | QHONJCJCPBLIIF-JBUSTKPGSA-N |
| XLogP | 0.74 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.29 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |