C20H27F3N4O8 — CID 171557786
2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid (PubChem CID 171557786) has the molecular formula C20H27F3N4O8 and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171557786 |
| Molecular Formula | C20H27F3N4O8 |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 2-[2-[2-[[(3aS,4R,7S,7aR)-2,2-dimethyl-7-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl]methylamino]-2-oxoethoxy]ethoxy]acetic acid |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](Nc1ccnc(C(F)(F)F)n1)CO[C@@H]2CNC(=O)COCCOCC(=O)O |
| InChI | InChI=1S/C20H27F3N4O8/c1-19(2)34-16-11(26-13-3-4-24-18(27-13)20(21,22)23)8-33-12(17(16)35-19)7-25-14(28)9-31-5-6-32-10-15(29)30/h3-4,11-12,16-17H,5-10H2,1-2H3,(H,25,28)(H,29,30)(H,24,26,27)/t11-,12+,16+,17-/m0/s1 |
| InChIKey | YSQKAZKVVVIGJH-SONRMIBWSA-N |
| XLogP | 0.43 |
| TPSA | 150.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|