C19H20F3N5O4S — CID 171557822
N-[(1S,2S,6R,7S,8S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,9,11-trioxa-5-thiatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557822) has the molecular formula C19H20F3N5O4S and a molecular weight of 471.46 g/mol. Its IUPAC name is N-[(1S,2S,6R,7S,8S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,9,11-trioxa-5-thiatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[(1S,2S,6R,7S,8S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,9,11-trioxa-5-thiatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557822 |
| Molecular Formula | C19H20F3N5O4S |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.12 |
| IUPAC Name | N-[(1S,2S,6R,7S,8S)-4,4-dimethyl-1-(pyrazin-2-yloxymethyl)-3,9,11-trioxa-5-thiatricyclo[6.2.1.02,6]undecan-7-yl]-6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC1(C)O[C@@H]2[C@H](S1)[C@@H](Nc1cncc(C(F)(F)F)n1)[C@H]1OC[C@]2(COc2cnccn2)O1 |
| InChI | InChI=1S/C19H20F3N5O4S/c1-17(2)30-15-14(32-17)13(27-11-6-24-5-10(26-11)19(20,21)22)16-29-9-18(15,31-16)8-28-12-7-23-3-4-25-12/h3-7,13-16H,8-9H2,1-2H3,(H,26,27)/t13-,14-,15-,16+,18+/m1/s1 |
| InChIKey | ZLHUTCNEZORKHJ-JLOCXQCDSA-N |
| XLogP | 2.51 |
| TPSA | 100.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |