C30H35F3N4O6 — CID 171557826
4-[4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoyl]phenyl]benzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557826) has the molecular formula C30H35F3N4O6 and a molecular weight of 604.63 g/mol. Its IUPAC name is 4-[4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoyl]phenyl]benzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | 4-[4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoyl]phenyl]benzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 171557826 |
| Molecular Formula | C30H35F3N4O6 |
| Molecular Weight | 604.63 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 4-[4-[(2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-4-yl)methylcarbamoyl]phenyl]benzoic acid;ethane;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | CC.CC1(C)OC2CCOC(CNC(=O)c3ccc(-c4ccc(C(=O)O)cc4)cc3)C2O1.Nc1cncc(C(F)(F)F)n1 |
| InChI | InChI=1S/C23H25NO6.C5H4F3N3.C2H6/c1-23(2)29-18-11-12-28-19(20(18)30-23)13-24-21(25)16-7-3-14(4-8-16)15-5-9-17(10-6-15)22(26)27;6-5(7,8)3-1-10-2-4(9)11-3;1-2/h3-10,18-20H,11-13H2,1-2H3,(H,24,25)(H,26,27);1-2H,(H2,9,11);1-2H3 |
| InChIKey | USMKQVZCSHTQME-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.63 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |