C13H18F3NO4 — CID 171557829
2-methoxy-6-(trifluoromethyl)pyridine;2-methyloxane-3,4-diol (PubChem CID 171557829) has the molecular formula C13H18F3NO4 and a molecular weight of 309.28 g/mol. Its IUPAC name is 2-methoxy-6-(trifluoromethyl)pyridine;2-methyloxane-3,4-diol.
| Compound Name | 2-methoxy-6-(trifluoromethyl)pyridine;2-methyloxane-3,4-diol |
|---|---|
| PubChem CID | 171557829 |
| Molecular Formula | C13H18F3NO4 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.12 |
| IUPAC Name | 2-methoxy-6-(trifluoromethyl)pyridine;2-methyloxane-3,4-diol |
| SMILES | CC1OCCC(O)C1O.COc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C7H6F3NO.C6H12O3/c1-12-6-4-2-3-5(11-6)7(8,9)10;1-4-6(8)5(7)2-3-9-4/h2-4H,1H3;4-8H,2-3H2,1H3 |
| InChIKey | LOOAKWVHDCSOJY-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 71.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |