C19H27F3N4O9 — CID 171557841
2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetic acid (PubChem CID 171557841) has the molecular formula C19H27F3N4O9 and a molecular weight of 512.44 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171557841 |
| Molecular Formula | C19H27F3N4O9 |
| Molecular Weight | 512.44 g/mol |
| Exact Mass | 512.17 |
| IUPAC Name | 2-[2-[2-[2-[[(2R,3R,4R,5S)-3,4-dihydroxy-5-[[6-(trifluoromethyl)pyrazin-2-yl]amino]oxan-2-yl]methylamino]-2-oxoethoxy]ethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOCC(=O)NC[C@H]1OC[C@H](Nc2cncc(C(F)(F)F)n2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C19H27F3N4O9/c20-19(21,22)13-6-23-7-14(26-13)25-11-8-35-12(18(31)17(11)30)5-24-15(27)9-33-3-1-32-2-4-34-10-16(28)29/h6-7,11-12,17-18,30-31H,1-5,8-10H2,(H,24,27)(H,25,26)(H,28,29)/t11-,12+,17+,18-/m0/s1 |
| InChIKey | RGCHAEJCULBDRI-MIFHMHLRSA-N |
| XLogP | -1.35 |
| TPSA | 181.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.44 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|