About 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine
2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (PubChem CID 171557854) has the molecular formula C17H20F3N3O4
and a molecular weight of 387.36 g/mol. Its IUPAC name is 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
Molecular Properties
| Compound Name | 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| PubChem CID | 171557854 |
| Molecular Formula | C17H20F3N3O4 |
| Molecular Weight | 387.36 g/mol |
| Exact Mass | 387.14 |
| IUPAC Name | 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine |
| SMILES | Nc1cncc(C(F)(F)F)n1.OC1CCOC(COc2ccccc2)C1O |
| InChI | InChI=1S/C12H16O4.C5H4F3N3/c13-10-6-7-15-11(12(10)14)8-16-9-4-2-1-3-5-9;6-5(7,8)3-1-10-2-4(9)11-3/h1-5,10-14H,6-8H2;1-2H,(H2,9,11) |
| InChIKey | GVXPFSLWTBMCHV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The IUPAC name of 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine (CID 171557854) is 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine.
What is the SMILES notation for 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The canonical SMILES for 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine is Nc1cncc(C(F)(F)F)n1.OC1CCOC(COc2ccccc2)C1O.
What is the InChIKey of 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
The InChIKey is GVXPFSLWTBMCHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O4.C5H4F3N3/c13-10-6-7-15-11(12(10)14)8-16-9-4-2-1-3-5-9;6-5(7,8)3-1-10-2-4(9)11-3/h1-5,10-14H,6-8H2;1-2H,(H2,9,11).
What are the key properties of 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine?
2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine has a molecular weight of 387.36 g/mol, XLogP of 1.65, 3 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(phenoxymethyl)oxane-3,4-diol;6-(trifluoromethyl)pyrazin-2-amine is sourced from PubChem (CID 171557854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).